C23H30F3N3O5 — CID 87349466
[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylcyclohexyl] 2,2,2-trifluoroacetate (PubChem CID 87349466) has the molecular formula C23H30F3N3O5 and a molecular weight of 485.50 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylcyclohexyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylcyclohexyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87349466 |
| Molecular Formula | C23H30F3N3O5 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)-1-propan-2-ylcyclohexyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)[C@@]1(OC(=O)C(F)(F)F)CC[C@H](C(=O)N2CCN(c3ccccc3)CC2)[C@@H](C(=O)NO)C1 |
| InChI | InChI=1S/C23H30F3N3O5/c1-15(2)22(34-21(32)23(24,25)26)9-8-17(18(14-22)19(30)27-33)20(31)29-12-10-28(11-13-29)16-6-4-3-5-7-16/h3-7,15,17-18,33H,8-14H2,1-2H3,(H,27,30)/t17-,18-,22+/m0/s1 |
| InChIKey | IVWGCRIJPXOMEL-NPPFBWRTSA-N |
| XLogP | 2.76 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|