About CID 87350258
CID 87350258 (PubChem CID 87350258) has the molecular formula C21H20BN
and a molecular weight of 297.21 g/mol.
Molecular Properties
| Compound Name | CID 87350258 |
| PubChem CID | 87350258 |
| Molecular Formula | C21H20BN |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | — |
| SMILES | [B]C(c1ccccc1)(c1ccc(C(C)C)cc1)c1ccccn1 |
| InChI | InChI=1S/C21H20BN/c1-16(2)17-11-13-19(14-12-17)21(22,18-8-4-3-5-9-18)20-10-6-7-15-23-20/h3-16H,1-2H3 |
| InChIKey | ZZAJZFMTNRQQRE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87350258 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87350258?
The IUPAC name of CID 87350258 (CID 87350258) is not available.
What is the SMILES notation for CID 87350258?
The canonical SMILES for CID 87350258 is [B]C(c1ccccc1)(c1ccc(C(C)C)cc1)c1ccccn1.
What is the InChIKey of CID 87350258?
The InChIKey is ZZAJZFMTNRQQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BN/c1-16(2)17-11-13-19(14-12-17)21(22,18-8-4-3-5-9-18)20-10-6-7-15-23-20/h3-16H,1-2H3.
What are the key properties of CID 87350258?
CID 87350258 has a molecular weight of 297.21 g/mol, XLogP of 4.67, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87350258 is sourced from PubChem (CID 87350258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).