C19H20N6O3 — CID 87350427
4-[1-[1-(4-methoxyphenyl)propyl]pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;nitrous acid (PubChem CID 87350427) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-[1-[1-(4-methoxyphenyl)propyl]pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;nitrous acid.
| Compound Name | 4-[1-[1-(4-methoxyphenyl)propyl]pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;nitrous acid |
|---|---|
| PubChem CID | 87350427 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-[1-[1-(4-methoxyphenyl)propyl]pyrazol-4-yl]-7H-pyrrolo[2,3-d]pyrimidine;nitrous acid |
| SMILES | CCC(c1ccc(OC)cc1)n1cc(-c2ncnc3[nH]ccc23)cn1.O=NO |
| InChI | InChI=1S/C19H19N5O.HNO2/c1-3-17(13-4-6-15(25-2)7-5-13)24-11-14(10-23-24)18-16-8-9-20-19(16)22-12-21-18;2-1-3/h4-12,17H,3H2,1-2H3,(H,20,21,22);(H,2,3) |
| InChIKey | VUMHVYPZNKYDHR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|