About N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane
N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane (PubChem CID 87350627) has the molecular formula C7H17Cl3NP
and a molecular weight of 252.55 g/mol. Its IUPAC name is N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane.
Molecular Properties
| Compound Name | N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane |
| PubChem CID | 87350627 |
| Molecular Formula | C7H17Cl3NP |
| Molecular Weight | 252.55 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane |
| SMILES | CC(C)(CCl)N(Cl)Cl.CP(C)C |
| InChI | InChI=1S/C4H8Cl3N.C3H9P/c1-4(2,3-5)8(6)7;1-4(2)3/h3H2,1-2H3;1-3H3 |
| InChIKey | LQFIOPKHLWRKLD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane?
The IUPAC name of N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane (CID 87350627) is N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane.
What is the SMILES notation for N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane?
The canonical SMILES for N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane is CC(C)(CCl)N(Cl)Cl.CP(C)C.
What is the InChIKey of N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane?
The InChIKey is LQFIOPKHLWRKLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl3N.C3H9P/c1-4(2,3-5)8(6)7;1-4(2)3/h3H2,1-2H3;1-3H3.
What are the key properties of N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane?
N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane has a molecular weight of 252.55 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,1-trichloro-2-methylpropan-2-amine;trimethylphosphane is sourced from PubChem (CID 87350627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).