C26H27I2N3Pt — CID 87351700
(1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum;1-(3,4-dimethylphenyl)-N,N-diiodomethanamine (PubChem CID 87351700) has the molecular formula C26H27I2N3Pt and a molecular weight of 830.41 g/mol. Its IUPAC name is (1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum;1-(3,4-dimethylphenyl)-N,N-diiodomethanamine.
| Compound Name | (1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum;1-(3,4-dimethylphenyl)-N,N-diiodomethanamine |
|---|---|
| PubChem CID | 87351700 |
| Molecular Formula | C26H27I2N3Pt |
| Molecular Weight | 830.41 g/mol |
| Exact Mass | 829.99 |
| IUPAC Name | (1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum;1-(3,4-dimethylphenyl)-N,N-diiodomethanamine |
| SMILES | Cc1ccc(CN(I)I)cc1C.Cn1c(-c2ccccc2)c(-c2ccccc2)n(C)c1=[Pt] |
| InChI | InChI=1S/C17H16N2.C9H11I2N.Pt/c1-18-13-19(2)17(15-11-7-4-8-12-15)16(18)14-9-5-3-6-10-14;1-7-3-4-9(5-8(7)2)6-12(10)11;/h3-12H,1-2H3;3-5H,6H2,1-2H3; |
| InChIKey | VWCADTYLUOIJKY-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.41 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|