About N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum
N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum (PubChem CID 87352015) has the molecular formula C13H21I2N3Pt
and a molecular weight of 668.22 g/mol. Its IUPAC name is N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum.
Molecular Properties
| Compound Name | N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum |
| PubChem CID | 87352015 |
| Molecular Formula | C13H21I2N3Pt |
| Molecular Weight | 668.22 g/mol |
| Exact Mass | 667.95 |
| IUPAC Name | N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum |
| SMILES | Cn1ccn(C)c1=[Pt].IN(I)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C8H13I2N.C5H8N2.Pt/c9-11(10)8-4-1-7(2-5-8)3-6-8;1-6-3-4-7(2)5-6;/h7H,1-6H2;3-4H,1-2H3; |
| InChIKey | NOMQKJPMMWZBAF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 668.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum?
The IUPAC name of N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum (CID 87352015) is N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum.
What is the SMILES notation for N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum?
The canonical SMILES for N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum is Cn1ccn(C)c1=[Pt].IN(I)C12CCC(CC1)CC2.
What is the InChIKey of N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum?
The InChIKey is NOMQKJPMMWZBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13I2N.C5H8N2.Pt/c9-11(10)8-4-1-7(2-5-8)3-6-8;1-6-3-4-7(2)5-6;/h7H,1-6H2;3-4H,1-2H3;.
What are the key properties of N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum?
N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum has a molecular weight of 668.22 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diiodobicyclo[2.2.2]octan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum is sourced from PubChem (CID 87352015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).