About (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine
(1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine (PubChem CID 87352074) has the molecular formula C18H27I2N3Pt
and a molecular weight of 734.32 g/mol. Its IUPAC name is (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine.
Molecular Properties
| Compound Name | (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine |
| PubChem CID | 87352074 |
| Molecular Formula | C18H27I2N3Pt |
| Molecular Weight | 734.32 g/mol |
| Exact Mass | 733.99 |
| IUPAC Name | (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine |
| SMILES | Cc1cn(C2CC2)c(=[Pt])n1C1CC1.IN(I)C12CCC(CC1)CC2 |
| InChI | InChI=1S/C10H14N2.C8H13I2N.Pt/c1-8-6-11(9-2-3-9)7-12(8)10-4-5-10;9-11(10)8-4-1-7(2-5-8)3-6-8;/h6,9-10H,2-5H2,1H3;7H,1-6H2; |
| InChIKey | ULYJMLVOONQAJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 734.32 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine?
The IUPAC name of (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine (CID 87352074) is (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine.
What is the SMILES notation for (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine?
The canonical SMILES for (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine is Cc1cn(C2CC2)c(=[Pt])n1C1CC1.IN(I)C12CCC(CC1)CC2.
What is the InChIKey of (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine?
The InChIKey is ULYJMLVOONQAJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2.C8H13I2N.Pt/c1-8-6-11(9-2-3-9)7-12(8)10-4-5-10;9-11(10)8-4-1-7(2-5-8)3-6-8;/h6,9-10H,2-5H2,1H3;7H,1-6H2;.
What are the key properties of (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine?
(1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine has a molecular weight of 734.32 g/mol, XLogP of 6.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dicyclopropyl-4-methylimidazol-2-ylidene)platinum;N,N-diiodobicyclo[2.2.2]octan-1-amine is sourced from PubChem (CID 87352074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).