C17H18F3I2N5O2Pt — CID 87352178
N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1,3,7,9-tetramethyl-2,6-dioxopurin-8-ylidene)platinum (PubChem CID 87352178) has the molecular formula C17H18F3I2N5O2Pt and a molecular weight of 830.24 g/mol. Its IUPAC name is N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1,3,7,9-tetramethyl-2,6-dioxopurin-8-ylidene)platinum.
| Compound Name | N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1,3,7,9-tetramethyl-2,6-dioxopurin-8-ylidene)platinum |
|---|---|
| PubChem CID | 87352178 |
| Molecular Formula | C17H18F3I2N5O2Pt |
| Molecular Weight | 830.24 g/mol |
| Exact Mass | 829.91 |
| IUPAC Name | N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1,3,7,9-tetramethyl-2,6-dioxopurin-8-ylidene)platinum |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)n(C)c(=[Pt])n2C.FC(F)(F)c1ccc(CN(I)I)cc1 |
| InChI | InChI=1S/C9H12N4O2.C8H6F3I2N.Pt/c1-10-5-11(2)7-6(10)8(14)13(4)9(15)12(7)3;9-8(10,11)7-3-1-6(2-4-7)5-14(12)13;/h1-4H3;1-4H,5H2; |
| InChIKey | UQAFATDSPNOZIZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|