About [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine
[1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine (PubChem CID 87352219) has the molecular formula C18H31I2N3Pt
and a molecular weight of 738.35 g/mol. Its IUPAC name is [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine.
Molecular Properties
| Compound Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine |
| PubChem CID | 87352219 |
| Molecular Formula | C18H31I2N3Pt |
| Molecular Weight | 738.35 g/mol |
| Exact Mass | 738.03 |
| IUPAC Name | [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine |
| SMILES | Cn1ccn(CC2CCCCC2)c1=[Pt].IN(I)C1CCCCCC1 |
| InChI | InChI=1S/C11H18N2.C7H13I2N.Pt/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;8-10(9)7-5-3-1-2-4-6-7;/h7-8,11H,2-6,9H2,1H3;7H,1-6H2; |
| InChIKey | QZIHDHDIHKAEJP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 738.35 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine?
The IUPAC name of [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine (CID 87352219) is [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine.
What is the SMILES notation for [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine?
The canonical SMILES for [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine is Cn1ccn(CC2CCCCC2)c1=[Pt].IN(I)C1CCCCCC1.
What is the InChIKey of [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine?
The InChIKey is QZIHDHDIHKAEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2.C7H13I2N.Pt/c1-12-7-8-13(10-12)9-11-5-3-2-4-6-11;8-10(9)7-5-3-1-2-4-6-7;/h7-8,11H,2-6,9H2,1H3;7H,1-6H2;.
What are the key properties of [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine?
[1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine has a molecular weight of 738.35 g/mol, XLogP of 6.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyclohexylmethyl)-3-methylimidazol-2-ylidene]platinum;N,N-diiodocycloheptanamine is sourced from PubChem (CID 87352219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).