C8H21N3 — CID 87352361
1-N,1-N,2-trimethylpentane-1,3,5-triamine (PubChem CID 87352361) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is 1-N,1-N,2-trimethylpentane-1,3,5-triamine.
| Compound Name | 1-N,1-N,2-trimethylpentane-1,3,5-triamine |
|---|---|
| PubChem CID | 87352361 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | 1-N,1-N,2-trimethylpentane-1,3,5-triamine |
| SMILES | CC(CN(C)C)C(N)CCN |
| InChI | InChI=1S/C8H21N3/c1-7(6-11(2)3)8(10)4-5-9/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | QYYXZZDMCAEMTH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |