About 2-bromo-N-carbamoyl-2-ethylbutanamide;decane
2-bromo-N-carbamoyl-2-ethylbutanamide;decane (PubChem CID 87352575) has the molecular formula C17H35BrN2O2
and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-bromo-N-carbamoyl-2-ethylbutanamide;decane.
Molecular Properties
| Compound Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;decane |
| PubChem CID | 87352575 |
| Molecular Formula | C17H35BrN2O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-bromo-N-carbamoyl-2-ethylbutanamide;decane |
| SMILES | CCC(Br)(CC)C(=O)NC(N)=O.CCCCCCCCCC |
| InChI | InChI=1S/C10H22.C7H13BrN2O2/c1-3-5-7-9-10-8-6-4-2;1-3-7(8,4-2)5(11)10-6(9)12/h3-10H2,1-2H3;3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | QZKXEGFWARMFFY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-carbamoyl-2-ethylbutanamide;decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;decane?
The IUPAC name of 2-bromo-N-carbamoyl-2-ethylbutanamide;decane (CID 87352575) is 2-bromo-N-carbamoyl-2-ethylbutanamide;decane.
What is the SMILES notation for 2-bromo-N-carbamoyl-2-ethylbutanamide;decane?
The canonical SMILES for 2-bromo-N-carbamoyl-2-ethylbutanamide;decane is CCC(Br)(CC)C(=O)NC(N)=O.CCCCCCCCCC.
What is the InChIKey of 2-bromo-N-carbamoyl-2-ethylbutanamide;decane?
The InChIKey is QZKXEGFWARMFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.C7H13BrN2O2/c1-3-5-7-9-10-8-6-4-2;1-3-7(8,4-2)5(11)10-6(9)12/h3-10H2,1-2H3;3-4H2,1-2H3,(H3,9,10,11,12).
What are the key properties of 2-bromo-N-carbamoyl-2-ethylbutanamide;decane?
2-bromo-N-carbamoyl-2-ethylbutanamide;decane has a molecular weight of 379.38 g/mol, XLogP of 5.28, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-carbamoyl-2-ethylbutanamide;decane is sourced from PubChem (CID 87352575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).