About 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid
2-(2-amino-1,3-thiazol-4-yl)pentanoic acid (PubChem CID 87353061) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid |
| PubChem CID | 87353061 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-3-5(7(11)12)6-4-13-8(9)10-6/h4-5H,2-3H2,1H3,(H2,9,10)(H,11,12) |
| InChIKey | LMKXJEYVZZHVLK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid (CID 87353061) is 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid is CCCC(C(=O)O)c1csc(N)n1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid?
The InChIKey is LMKXJEYVZZHVLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-2-3-5(7(11)12)6-4-13-8(9)10-6/h4-5H,2-3H2,1H3,(H2,9,10)(H,11,12).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid?
2-(2-amino-1,3-thiazol-4-yl)pentanoic acid has a molecular weight of 200.26 g/mol, XLogP of 1.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)pentanoic acid is sourced from PubChem (CID 87353061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).