C22H16N6S2 — CID 87353099
2-[[2-[2-[5-[(2-cyanophenyl)methyl]-1,3-thiazol-2-yl]hydrazinyl]-1,3-thiazol-5-yl]methyl]benzonitrile (PubChem CID 87353099) has the molecular formula C22H16N6S2 and a molecular weight of 428.55 g/mol. Its IUPAC name is 2-[[2-[2-[5-[(2-cyanophenyl)methyl]-1,3-thiazol-2-yl]hydrazinyl]-1,3-thiazol-5-yl]methyl]benzonitrile.
| Compound Name | 2-[[2-[2-[5-[(2-cyanophenyl)methyl]-1,3-thiazol-2-yl]hydrazinyl]-1,3-thiazol-5-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 87353099 |
| Molecular Formula | C22H16N6S2 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[[2-[2-[5-[(2-cyanophenyl)methyl]-1,3-thiazol-2-yl]hydrazinyl]-1,3-thiazol-5-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cc1cnc(NNc2ncc(Cc3ccccc3C#N)s2)s1 |
| InChI | InChI=1S/C22H16N6S2/c23-11-17-7-3-1-5-15(17)9-19-13-25-21(29-19)27-28-22-26-14-20(30-22)10-16-6-2-4-8-18(16)12-24/h1-8,13-14H,9-10H2,(H,25,27)(H,26,28) |
| InChIKey | MQCYOAPPCVGUOH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|