C21H30OS — CID 87353523
2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)cyclohexa-2,4-diene-1-thione (PubChem CID 87353523) has the molecular formula C21H30OS and a molecular weight of 330.54 g/mol. Its IUPAC name is 2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)cyclohexa-2,4-diene-1-thione.
| Compound Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)cyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87353523 |
| Molecular Formula | C21H30OS |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)cyclohexa-2,4-diene-1-thione |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC1=CC=CCC1=S |
| InChI | InChI=1S/C21H30OS/c1-17(2)9-7-10-18(3)11-8-12-19(4)15-16-22-20-13-5-6-14-21(20)23/h5-6,9,11,13,15H,7-8,10,12,14,16H2,1-4H3 |
| InChIKey | YHOBTTWCLVBMBR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|