About cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron
cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron (PubChem CID 87353614) has the molecular formula C18H19FeN-6
and a molecular weight of 305.20 g/mol. Its IUPAC name is cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron.
Molecular Properties
| Compound Name | cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron |
| PubChem CID | 87353614 |
| Molecular Formula | C18H19FeN-6 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron |
| SMILES | CN(C)[c-]1cccc1-c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C13H14N.C5H5.Fe/c1-14(2)13-10-6-9-12(13)11-7-4-3-5-8-11;1-2-4-5-3-1;/h3-10H,1-2H3;1-5H;/q-1;-5; |
| InChIKey | KTGAPQQFMXWSFO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron?
The IUPAC name of cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron (CID 87353614) is cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron.
What is the SMILES notation for cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron?
The canonical SMILES for cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron is CN(C)[c-]1cccc1-c1ccccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron?
The InChIKey is KTGAPQQFMXWSFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N.C5H5.Fe/c1-14(2)13-10-6-9-12(13)11-7-4-3-5-8-11;1-2-4-5-3-1;/h3-10H,1-2H3;1-5H;/q-1;-5;.
What are the key properties of cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron?
cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron has a molecular weight of 305.20 g/mol, XLogP of 4.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentane;N,N-dimethyl-2-phenylcyclopenta-2,4-dien-1-amine;iron is sourced from PubChem (CID 87353614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).