C6H11N3O3 — CID 87353732
7-(hydroxyamino)-2,3,5,6-tetrahydro-1,4-diazepine-4-carboxylic acid (PubChem CID 87353732) has the molecular formula C6H11N3O3 and a molecular weight of 173.17 g/mol. Its IUPAC name is 7-(hydroxyamino)-2,3,5,6-tetrahydro-1,4-diazepine-4-carboxylic acid.
| Compound Name | 7-(hydroxyamino)-2,3,5,6-tetrahydro-1,4-diazepine-4-carboxylic acid |
|---|---|
| PubChem CID | 87353732 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 7-(hydroxyamino)-2,3,5,6-tetrahydro-1,4-diazepine-4-carboxylic acid |
| SMILES | O=C(O)N1CCN=C(NO)CC1 |
| InChI | InChI=1S/C6H11N3O3/c10-6(11)9-3-1-5(8-12)7-2-4-9/h12H,1-4H2,(H,7,8)(H,10,11) |
| InChIKey | UDMWUQYUUHJKMW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|