About CID 87353970
CID 87353970 (PubChem CID 87353970) has the molecular formula C46H48N4O2
and a molecular weight of 688.92 g/mol.
Molecular Properties
| Compound Name | CID 87353970 |
| PubChem CID | 87353970 |
| Molecular Formula | C46H48N4O2 |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 688.38 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1=CC2(C=C(C(C)(C)C)C1=O)C1(CC1)C1(C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1)C21C(=C(C#N)C#N)c2ccccc2C1=C(C#N)C#N |
| InChI | InChI=1S/C46H48N4O2/c1-39(2,3)31-19-44(20-32(37(31)51)40(4,5)6)43(17-18-43)45(21-33(41(7,8)9)38(52)34(22-45)42(10,11)12)46(44)35(27(23-47)24-48)29-15-13-14-16-30(29)36(46)28(25-49)26-50/h13-16,19-22H,17-18H2,1-12H3 |
| InChIKey | LVTZQGGBOWCBBK-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 129.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze CID 87353970 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87353970?
The IUPAC name of CID 87353970 (CID 87353970) is not available.
What is the SMILES notation for CID 87353970?
The canonical SMILES for CID 87353970 is CC(C)(C)C1=CC2(C=C(C(C)(C)C)C1=O)C1(CC1)C1(C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1)C21C(=C(C#N)C#N)c2ccccc2C1=C(C#N)C#N.
What is the InChIKey of CID 87353970?
The InChIKey is LVTZQGGBOWCBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H48N4O2/c1-39(2,3)31-19-44(20-32(37(31)51)40(4,5)6)43(17-18-43)45(21-33(41(7,8)9)38(52)34(22-45)42(10,11)12)46(44)35(27(23-47)24-48)29-15-13-14-16-30(29)36(46)28(25-49)26-50/h13-16,19-22H,17-18H2,1-12H3.
What are the key properties of CID 87353970?
CID 87353970 has a molecular weight of 688.92 g/mol, XLogP of 10.11, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87353970 is sourced from PubChem (CID 87353970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).