C8H10Cl2N2O10S2 — CID 87354464
1-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid;1-hydroxypyrrolidine-2,5-dione;thionyl dichloride (PubChem CID 87354464) has the molecular formula C8H10Cl2N2O10S2 and a molecular weight of 429.21 g/mol. Its IUPAC name is 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid;1-hydroxypyrrolidine-2,5-dione;thionyl dichloride.
| Compound Name | 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid;1-hydroxypyrrolidine-2,5-dione;thionyl dichloride |
|---|---|
| PubChem CID | 87354464 |
| Molecular Formula | C8H10Cl2N2O10S2 |
| Molecular Weight | 429.21 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 1-hydroxy-2,5-dioxopyrrolidine-3-sulfonic acid;1-hydroxypyrrolidine-2,5-dione;thionyl dichloride |
| SMILES | O=C1CC(S(=O)(=O)O)C(=O)N1O.O=C1CCC(=O)N1O.O=S(Cl)Cl |
| InChI | InChI=1S/C4H5NO6S.C4H5NO3.Cl2OS/c6-3-1-2(12(9,10)11)4(7)5(3)8;6-3-1-2-4(7)5(3)8;1-4(2)3/h2,8H,1H2,(H,9,10,11);8H,1-2H2; |
| InChIKey | XVPOVZKQEAHLNY-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|