About 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane
1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane (PubChem CID 87354604) has the molecular formula C6H10Br4S
and a molecular weight of 433.83 g/mol. Its IUPAC name is 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane.
Molecular Properties
| Compound Name | 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane |
| PubChem CID | 87354604 |
| Molecular Formula | C6H10Br4S |
| Molecular Weight | 433.83 g/mol |
| Exact Mass | 429.72 |
| IUPAC Name | 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane |
| SMILES | BrCC(Br)CSCC(Br)CBr |
| InChI | InChI=1S/C6H10Br4S/c7-1-5(9)3-11-4-6(10)2-8/h5-6H,1-4H2 |
| InChIKey | JQNMYGUHQKMHLC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane?
The IUPAC name of 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane (CID 87354604) is 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane.
What is the SMILES notation for 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane?
The canonical SMILES for 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane is BrCC(Br)CSCC(Br)CBr.
What is the InChIKey of 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane?
The InChIKey is JQNMYGUHQKMHLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Br4S/c7-1-5(9)3-11-4-6(10)2-8/h5-6H,1-4H2.
What are the key properties of 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane?
1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane has a molecular weight of 433.83 g/mol, XLogP of 4.04, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibromo-3-(2,3-dibromopropylsulfanyl)propane is sourced from PubChem (CID 87354604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).