About 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde
6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde (PubChem CID 87354925) has the molecular formula C12H15BrN2O2
and a molecular weight of 299.17 g/mol. Its IUPAC name is 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde |
| PubChem CID | 87354925 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde |
| SMILES | C[C@@H]1CN(c2ccc(Br)nc2C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C12H15BrN2O2/c1-8-5-15(6-9(2)17-8)11-3-4-12(13)14-10(11)7-16/h3-4,7-9H,5-6H2,1-2H3/t8-,9+ |
| InChIKey | UZHVADXLGTVKJG-DTORHVGOSA-N |
| XLogP | 2.27 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde?
The IUPAC name of 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde (CID 87354925) is 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde.
What is the SMILES notation for 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde?
The canonical SMILES for 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde is C[C@@H]1CN(c2ccc(Br)nc2C=O)C[C@H](C)O1.
What is the InChIKey of 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde?
The InChIKey is UZHVADXLGTVKJG-DTORHVGOSA-N. The full InChI is InChI=1S/C12H15BrN2O2/c1-8-5-15(6-9(2)17-8)11-3-4-12(13)14-10(11)7-16/h3-4,7-9H,5-6H2,1-2H3/t8-,9+.
What are the key properties of 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde?
6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde has a molecular weight of 299.17 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyridine-2-carbaldehyde is sourced from PubChem (CID 87354925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).