C25H25F5N4O5 — CID 87355182
methyl 2-[[2-[[5,5-dimethyl-2,4-dioxo-3-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazolidin-1-yl]methyl]-5-fluorophenyl]carbamoylamino]-2-methylpropanoate (PubChem CID 87355182) has the molecular formula C25H25F5N4O5 and a molecular weight of 556.49 g/mol. Its IUPAC name is methyl 2-[[2-[[5,5-dimethyl-2,4-dioxo-3-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazolidin-1-yl]methyl]-5-fluorophenyl]carbamoylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-[[5,5-dimethyl-2,4-dioxo-3-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazolidin-1-yl]methyl]-5-fluorophenyl]carbamoylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 87355182 |
| Molecular Formula | C25H25F5N4O5 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | methyl 2-[[2-[[5,5-dimethyl-2,4-dioxo-3-(2,3,4,6-tetrafluoro-5-methylphenyl)imidazolidin-1-yl]methyl]-5-fluorophenyl]carbamoylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)Nc1cc(F)ccc1CN1C(=O)N(c2c(F)c(C)c(F)c(F)c2F)C(=O)C1(C)C |
| InChI | InChI=1S/C25H25F5N4O5/c1-11-15(27)17(29)18(30)19(16(11)28)34-20(35)25(4,5)33(23(34)38)10-12-7-8-13(26)9-14(12)31-22(37)32-24(2,3)21(36)39-6/h7-9H,10H2,1-6H3,(H2,31,32,37) |
| InChIKey | AZPAZTGBCUMYHM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|