About 2,2,2-trifluoro-1-triethylsilylethanone;hydrate
2,2,2-trifluoro-1-triethylsilylethanone;hydrate (PubChem CID 87355331) has the molecular formula C8H17F3O2Si
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-triethylsilylethanone;hydrate.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-1-triethylsilylethanone;hydrate |
| PubChem CID | 87355331 |
| Molecular Formula | C8H17F3O2Si |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2,2,2-trifluoro-1-triethylsilylethanone;hydrate |
| SMILES | CC[Si](CC)(CC)C(=O)C(F)(F)F.O |
| InChI | InChI=1S/C8H15F3OSi.H2O/c1-4-13(5-2,6-3)7(12)8(9,10)11;/h4-6H2,1-3H3;1H2 |
| InChIKey | FGLWDLQDGNFJCX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-1-triethylsilylethanone;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-1-triethylsilylethanone;hydrate?
The IUPAC name of 2,2,2-trifluoro-1-triethylsilylethanone;hydrate (CID 87355331) is 2,2,2-trifluoro-1-triethylsilylethanone;hydrate.
What is the SMILES notation for 2,2,2-trifluoro-1-triethylsilylethanone;hydrate?
The canonical SMILES for 2,2,2-trifluoro-1-triethylsilylethanone;hydrate is CC[Si](CC)(CC)C(=O)C(F)(F)F.O.
What is the InChIKey of 2,2,2-trifluoro-1-triethylsilylethanone;hydrate?
The InChIKey is FGLWDLQDGNFJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3OSi.H2O/c1-4-13(5-2,6-3)7(12)8(9,10)11;/h4-6H2,1-3H3;1H2.
What are the key properties of 2,2,2-trifluoro-1-triethylsilylethanone;hydrate?
2,2,2-trifluoro-1-triethylsilylethanone;hydrate has a molecular weight of 230.30 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-1-triethylsilylethanone;hydrate is sourced from PubChem (CID 87355331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).