About silver;2,4,6-trinitrobenzene-1,3-diolate
silver;2,4,6-trinitrobenzene-1,3-diolate (PubChem CID 87355532) has the molecular formula C6HAgN3O8-2
and a molecular weight of 350.96 g/mol. Its IUPAC name is silver;2,4,6-trinitrobenzene-1,3-diolate.
Molecular Properties
| Compound Name | silver;2,4,6-trinitrobenzene-1,3-diolate |
| PubChem CID | 87355532 |
| Molecular Formula | C6HAgN3O8-2 |
| Molecular Weight | 350.96 g/mol |
| Exact Mass | 349.88 |
| IUPAC Name | silver;2,4,6-trinitrobenzene-1,3-diolate |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1[O-].[Ag] |
| InChI | InChI=1S/C6H3N3O8.Ag/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17;/h1,10-11H;/p-2 |
| InChIKey | BTCOUZXZQQJKCY-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 175.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.96 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver;2,4,6-trinitrobenzene-1,3-diolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;2,4,6-trinitrobenzene-1,3-diolate?
The IUPAC name of silver;2,4,6-trinitrobenzene-1,3-diolate (CID 87355532) is silver;2,4,6-trinitrobenzene-1,3-diolate.
What is the SMILES notation for silver;2,4,6-trinitrobenzene-1,3-diolate?
The canonical SMILES for silver;2,4,6-trinitrobenzene-1,3-diolate is O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1[O-].[Ag].
What is the InChIKey of silver;2,4,6-trinitrobenzene-1,3-diolate?
The InChIKey is BTCOUZXZQQJKCY-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H3N3O8.Ag/c10-5-2(7(12)13)1-3(8(14)15)6(11)4(5)9(16)17;/h1,10-11H;/p-2.
What are the key properties of silver;2,4,6-trinitrobenzene-1,3-diolate?
silver;2,4,6-trinitrobenzene-1,3-diolate has a molecular weight of 350.96 g/mol, XLogP of -0.44, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for silver;2,4,6-trinitrobenzene-1,3-diolate is sourced from PubChem (CID 87355532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).