C86H86N2 — CID 87355616
6-N,12-N-bis(2,4-dimethylphenyl)-6-N,12-N-bis[3-[2-[3-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]chrysene-6,12-diamine (PubChem CID 87355616) has the molecular formula C86H86N2 and a molecular weight of 1147.65 g/mol. Its IUPAC name is 6-N,12-N-bis(2,4-dimethylphenyl)-6-N,12-N-bis[3-[2-[3-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]chrysene-6,12-diamine.
| Compound Name | 6-N,12-N-bis(2,4-dimethylphenyl)-6-N,12-N-bis[3-[2-[3-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]chrysene-6,12-diamine |
|---|---|
| PubChem CID | 87355616 |
| Molecular Formula | C86H86N2 |
| Molecular Weight | 1147.65 g/mol |
| Exact Mass | 1146.68 |
| IUPAC Name | 6-N,12-N-bis(2,4-dimethylphenyl)-6-N,12-N-bis[3-[2-[3-(2,4,4-trimethylpentan-2-yl)phenyl]phenyl]phenyl]chrysene-6,12-diamine |
| SMILES | Cc1ccc(N(c2cccc(-c3ccccc3-c3cccc(C(C)(C)CC(C)(C)C)c3)c2)c2cc3c4ccccc4c(N(c4cccc(-c5ccccc5-c5cccc(C(C)(C)CC(C)(C)C)c5)c4)c4ccc(C)cc4C)cc3c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C86H86N2/c1-57-43-45-79(59(3)47-57)87(67-33-25-29-63(51-67)71-37-17-15-35-69(71)61-27-23-31-65(49-61)85(11,12)55-83(5,6)7)81-53-77-74-40-20-22-42-76(74)82(54-78(77)73-39-19-21-41-75(73)81)88(80-46-44-58(2)48-60(80)4)68-34-26-30-64(52-68)72-38-18-16-36-70(72)62-28-24-32-66(50-62)86(13,14)56-84(8,9)10/h15-54H,55-56H2,1-14H3 |
| InChIKey | TXVSAWWPTDZCHM-UHFFFAOYSA-N |
| XLogP | 25.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.65 |
| LogP ≤ 5 | 25.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|