C8H17NO7 — CID 87355666
N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]acetamide (PubChem CID 87355666) has the molecular formula C8H17NO7 and a molecular weight of 239.22 g/mol. Its IUPAC name is N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]acetamide.
| Compound Name | N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]acetamide |
|---|---|
| PubChem CID | 87355666 |
| Molecular Formula | C8H17NO7 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexyl]acetamide |
| SMILES | CC(=O)NC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H17NO7/c1-3(11)9-8(16)7(15)6(14)5(13)4(12)2-10/h4-8,10,12-16H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | KTWSJFYDCOMYKP-KEWYIRBNSA-N |
| XLogP | -4.12 |
| TPSA | 150.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|