About 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine
4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine (PubChem CID 87355868) has the molecular formula C19H14F9N
and a molecular weight of 427.31 g/mol. Its IUPAC name is 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine |
| PubChem CID | 87355868 |
| Molecular Formula | C19H14F9N |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine |
| SMILES | FC(F)(F)c1ccc(C2(c3ccc(C(F)(F)F)cc3)CC(C(F)(F)F)CN2)cc1 |
| InChI | InChI=1S/C19H14F9N/c20-17(21,22)13-5-1-11(2-6-13)16(9-15(10-29-16)19(26,27)28)12-3-7-14(8-4-12)18(23,24)25/h1-8,15,29H,9-10H2 |
| InChIKey | HNWVUJOECFKKPG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine?
The IUPAC name of 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine (CID 87355868) is 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine.
What is the SMILES notation for 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine?
The canonical SMILES for 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine is FC(F)(F)c1ccc(C2(c3ccc(C(F)(F)F)cc3)CC(C(F)(F)F)CN2)cc1.
What is the InChIKey of 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine?
The InChIKey is HNWVUJOECFKKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F9N/c20-17(21,22)13-5-1-11(2-6-13)16(9-15(10-29-16)19(26,27)28)12-3-7-14(8-4-12)18(23,24)25/h1-8,15,29H,9-10H2.
What are the key properties of 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine?
4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine has a molecular weight of 427.31 g/mol, XLogP of 6.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)-2,2-bis[4-(trifluoromethyl)phenyl]pyrrolidine is sourced from PubChem (CID 87355868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).