C18H15F7O2 — CID 87355900
[4-[4-(1,1,2,2,3,3,4-heptafluorobutoxymethyl)phenyl]phenyl]methanol (PubChem CID 87355900) has the molecular formula C18H15F7O2 and a molecular weight of 396.30 g/mol. Its IUPAC name is [4-[4-(1,1,2,2,3,3,4-heptafluorobutoxymethyl)phenyl]phenyl]methanol.
| Compound Name | [4-[4-(1,1,2,2,3,3,4-heptafluorobutoxymethyl)phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 87355900 |
| Molecular Formula | C18H15F7O2 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | [4-[4-(1,1,2,2,3,3,4-heptafluorobutoxymethyl)phenyl]phenyl]methanol |
| SMILES | OCc1ccc(-c2ccc(COC(F)(F)C(F)(F)C(F)(F)CF)cc2)cc1 |
| InChI | InChI=1S/C18H15F7O2/c19-11-16(20,21)17(22,23)18(24,25)27-10-13-3-7-15(8-4-13)14-5-1-12(9-26)2-6-14/h1-8,26H,9-11H2 |
| InChIKey | IYLBJDMMEPZVRI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|