About methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate
methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate (PubChem CID 87356054) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 87356054 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate |
| SMILES | COC(=O)C1=CCC(=NO)C=C1 |
| InChI | InChI=1S/C8H9NO3/c1-12-8(10)6-2-4-7(9-11)5-3-6/h2-4,11H,5H2,1H3 |
| InChIKey | MYPUERGRMJZMMS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate (CID 87356054) is methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate is COC(=O)C1=CCC(=NO)C=C1.
What is the InChIKey of methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate?
The InChIKey is MYPUERGRMJZMMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-12-8(10)6-2-4-7(9-11)5-3-6/h2-4,11H,5H2,1H3.
What are the key properties of methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate?
methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate has a molecular weight of 167.16 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hydroxyiminocyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 87356054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).