C11H9F2NO2 — CID 87356163
2-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]acetaldehyde (PubChem CID 87356163) has the molecular formula C11H9F2NO2 and a molecular weight of 225.19 g/mol. Its IUPAC name is 2-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]acetaldehyde.
| Compound Name | 2-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 87356163 |
| Molecular Formula | C11H9F2NO2 |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-[5-(2,6-difluorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]acetaldehyde |
| SMILES | O=CCC1=NOC(c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C11H9F2NO2/c12-8-2-1-3-9(13)11(8)10-6-7(4-5-15)14-16-10/h1-3,5,10H,4,6H2 |
| InChIKey | XENVUYKZGAHPNY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|