C30H35N3O5 — CID 87356233
3-[hydroxy-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]phenyl]-phenylmethyl]-N,N-dimethylbenzamide (PubChem CID 87356233) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is 3-[hydroxy-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]phenyl]-phenylmethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[hydroxy-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]phenyl]-phenylmethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 87356233 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 3-[hydroxy-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]phenyl]-phenylmethyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(C(O)(c2ccccc2)c2ccc(C(=O)NCCCCCCC(=O)NO)cc2)c1 |
| InChI | InChI=1S/C30H35N3O5/c1-33(2)29(36)23-11-10-14-26(21-23)30(37,24-12-6-5-7-13-24)25-18-16-22(17-19-25)28(35)31-20-9-4-3-8-15-27(34)32-38/h5-7,10-14,16-19,21,37-38H,3-4,8-9,15,20H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | PCSONGOQRPCZOC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|