About 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium (PubChem CID 87356853) has the molecular formula C13H23N2O3Sc-
and a molecular weight of 300.29 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium.
Molecular Properties
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium |
| PubChem CID | 87356853 |
| Molecular Formula | C13H23N2O3Sc- |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium |
| SMILES | NC(CO)(CO)CO.[CH2-]c1ccccc1N(C)C.[Sc] |
| InChI | InChI=1S/C9H12N.C4H11NO3.Sc/c1-8-6-4-5-7-9(8)10(2)3;5-4(1-6,2-7)3-8;/h4-7H,1H2,2-3H3;6-8H,1-3,5H2;/q-1;; |
| InChIKey | MDSPEHDXMRKOLI-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium?
The IUPAC name of 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium (CID 87356853) is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium.
What is the SMILES notation for 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium?
The canonical SMILES for 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium is NC(CO)(CO)CO.[CH2-]c1ccccc1N(C)C.[Sc].
What is the InChIKey of 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium?
The InChIKey is MDSPEHDXMRKOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.C4H11NO3.Sc/c1-8-6-4-5-7-9(8)10(2)3;5-4(1-6,2-7)3-8;/h4-7H,1H2,2-3H3;6-8H,1-3,5H2;/q-1;;.
What are the key properties of 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium?
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium has a molecular weight of 300.29 g/mol, XLogP of -0.41, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-methanidyl-N,N-dimethylaniline;scandium is sourced from PubChem (CID 87356853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).