C30H39N2OP — CID 87356862
N-[6-bis(3,5-diethylphenyl)phosphanyl-2-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 87356862) has the molecular formula C30H39N2OP and a molecular weight of 474.63 g/mol. Its IUPAC name is N-[6-bis(3,5-diethylphenyl)phosphanyl-2-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | N-[6-bis(3,5-diethylphenyl)phosphanyl-2-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 87356862 |
| Molecular Formula | C30H39N2OP |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-[6-bis(3,5-diethylphenyl)phosphanyl-2-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CCc1cc(CC)cc(P(c2cc(CC)cc(CC)c2)c2cccc(NC(=O)C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C30H39N2OP/c1-8-21-15-22(9-2)18-25(17-21)34(26-19-23(10-3)16-24(11-4)20-26)28-14-12-13-27(31-28)32-29(33)30(5,6)7/h12-20H,8-11H2,1-7H3,(H,31,32,33) |
| InChIKey | XCEWRXIJGGWBHT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|