About N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine
N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine (PubChem CID 87357047) has the molecular formula C21H47NO5P2
and a molecular weight of 455.56 g/mol. Its IUPAC name is N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine.
Molecular Properties
| Compound Name | N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine |
| PubChem CID | 87357047 |
| Molecular Formula | C21H47NO5P2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine |
| SMILES | CCOC(CPCCN(CCOC(C)C)CCPCC(OCC)OCC)OCC |
| InChI | InChI=1S/C21H47NO5P2/c1-7-23-20(24-8-2)17-28-15-12-22(11-14-27-19(5)6)13-16-29-18-21(25-9-3)26-10-4/h19-21,28-29H,7-18H2,1-6H3 |
| InChIKey | XIOFMXCRTDMEJM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine?
The IUPAC name of N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine (CID 87357047) is N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine.
What is the SMILES notation for N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine?
The canonical SMILES for N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine is CCOC(CPCCN(CCOC(C)C)CCPCC(OCC)OCC)OCC.
What is the InChIKey of N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine?
The InChIKey is XIOFMXCRTDMEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H47NO5P2/c1-7-23-20(24-8-2)17-28-15-12-22(11-14-27-19(5)6)13-16-29-18-21(25-9-3)26-10-4/h19-21,28-29H,7-18H2,1-6H3.
What are the key properties of N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine?
N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine has a molecular weight of 455.56 g/mol, XLogP of 3.87, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[2-(2,2-diethoxyethylphosphanyl)ethyl]-2-propan-2-yloxyethanamine is sourced from PubChem (CID 87357047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).