C52H44Cl2F12O2SiZr-2 — CID 87357807
bis(5-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-1-id-2-yl]-2,3-dimethylfuran);dichloro(dimethylsilylidene)zirconium (PubChem CID 87357807) has the molecular formula C52H44Cl2F12O2SiZr-2 and a molecular weight of 1119.11 g/mol. Its IUPAC name is bis(5-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-1-id-2-yl]-2,3-dimethylfuran);dichloro(dimethylsilylidene)zirconium.
| Compound Name | bis(5-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-1-id-2-yl]-2,3-dimethylfuran);dichloro(dimethylsilylidene)zirconium |
|---|---|
| PubChem CID | 87357807 |
| Molecular Formula | C52H44Cl2F12O2SiZr-2 |
| Molecular Weight | 1119.11 g/mol |
| Exact Mass | 1116.14 |
| IUPAC Name | bis(5-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-1-id-2-yl]-2,3-dimethylfuran);dichloro(dimethylsilylidene)zirconium |
| SMILES | CCc1ccc2[cH-]c(-c3cc(C)c(C)o3)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.CCc1ccc2[cH-]c(-c3cc(C)c(C)o3)cc2c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C25H19F6O.C2H6Si.2ClH.Zr/c2*1-4-15-5-6-16-8-17(22-7-13(2)14(3)32-22)11-21(16)23(15)18-9-19(24(26,27)28)12-20(10-18)25(29,30)31;1-3-2;;;/h2*5-12H,4H2,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | ZMYGTZWPXPEZFS-UHFFFAOYSA-L |
| XLogP | 19.57 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.11 |
| LogP ≤ 5 | 19.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|