About N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine
N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine (PubChem CID 87358172) has the molecular formula C24H53NO5P2
and a molecular weight of 497.64 g/mol. Its IUPAC name is N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine.
Molecular Properties
| Compound Name | N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine |
| PubChem CID | 87358172 |
| Molecular Formula | C24H53NO5P2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine |
| SMILES | CCOCCN(CCPCC(OC(C)C)OC(C)C)CCPCC(OC(C)C)OC(C)C |
| InChI | InChI=1S/C24H53NO5P2/c1-10-26-14-11-25(12-15-31-17-23(27-19(2)3)28-20(4)5)13-16-32-18-24(29-21(6)7)30-22(8)9/h19-24,31-32H,10-18H2,1-9H3 |
| InChIKey | GBOWXFLTZMFGCS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine?
The IUPAC name of N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine (CID 87358172) is N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine.
What is the SMILES notation for N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine?
The canonical SMILES for N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine is CCOCCN(CCPCC(OC(C)C)OC(C)C)CCPCC(OC(C)C)OC(C)C.
What is the InChIKey of N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine?
The InChIKey is GBOWXFLTZMFGCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H53NO5P2/c1-10-26-14-11-25(12-15-31-17-23(27-19(2)3)28-20(4)5)13-16-32-18-24(29-21(6)7)30-22(8)9/h19-24,31-32H,10-18H2,1-9H3.
What are the key properties of N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine?
N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine has a molecular weight of 497.64 g/mol, XLogP of 5.03, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[2-[2,2-di(propan-2-yloxy)ethylphosphanyl]ethyl]-2-ethoxyethanamine is sourced from PubChem (CID 87358172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).