About 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde
2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde (PubChem CID 87358758) has the molecular formula C9H7BrO3
and a molecular weight of 243.06 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde |
| PubChem CID | 87358758 |
| Molecular Formula | C9H7BrO3 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.96 |
| IUPAC Name | 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)OC(CBr)O2 |
| InChI | InChI=1S/C9H7BrO3/c10-4-9-12-7-2-1-6(5-11)3-8(7)13-9/h1-3,5,9H,4H2 |
| InChIKey | XEEQDFYXWDWWNC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde?
The IUPAC name of 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde (CID 87358758) is 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde.
What is the SMILES notation for 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde?
The canonical SMILES for 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde is O=Cc1ccc2c(c1)OC(CBr)O2.
What is the InChIKey of 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde?
The InChIKey is XEEQDFYXWDWWNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrO3/c10-4-9-12-7-2-1-6(5-11)3-8(7)13-9/h1-3,5,9H,4H2.
What are the key properties of 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde?
2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde has a molecular weight of 243.06 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1,3-benzodioxole-5-carbaldehyde is sourced from PubChem (CID 87358758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).