About 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran
2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran (PubChem CID 87358907) has the molecular formula C24H18F6O
and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran.
Molecular Properties
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran |
| PubChem CID | 87358907 |
| Molecular Formula | C24H18F6O |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran |
| SMILES | CCc1ccc2c(c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C=C(c1ccc(C)o1)C2 |
| InChI | InChI=1S/C24H18F6O/c1-3-14-5-6-15-8-16(21-7-4-13(2)31-21)11-20(15)22(14)17-9-18(23(25,26)27)12-19(10-17)24(28,29)30/h4-7,9-12H,3,8H2,1-2H3 |
| InChIKey | XWFJJHILWCPSTC-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran?
The IUPAC name of 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran (CID 87358907) is 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran.
What is the SMILES notation for 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran?
The canonical SMILES for 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran is CCc1ccc2c(c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C=C(c1ccc(C)o1)C2.
What is the InChIKey of 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran?
The InChIKey is XWFJJHILWCPSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F6O/c1-3-14-5-6-15-8-16(21-7-4-13(2)31-21)11-20(15)22(14)17-9-18(23(25,26)27)12-19(10-17)24(28,29)30/h4-7,9-12H,3,8H2,1-2H3.
What are the key properties of 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran?
2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran has a molecular weight of 436.40 g/mol, XLogP of 7.95, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,5-bis(trifluoromethyl)phenyl]-5-ethyl-1H-inden-2-yl]-5-methylfuran is sourced from PubChem (CID 87358907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).