About 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine
1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine (PubChem CID 87358909) has the molecular formula C6H18N7O3P
and a molecular weight of 267.23 g/mol. Its IUPAC name is 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine.
Molecular Properties
| Compound Name | 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine |
| PubChem CID | 87358909 |
| Molecular Formula | C6H18N7O3P |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine |
| SMILES | CC/N=C(\N)NOP(N)(=O)ON/C(N)=N/CC |
| InChI | InChI=1S/C6H18N7O3P/c1-3-10-5(7)12-15-17(9,14)16-13-6(8)11-4-2/h3-4H2,1-2H3,(H2,9,14)(H3,7,10,12)(H3,8,11,13) |
| InChIKey | LJDVYLACJGSKOT-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine?
The IUPAC name of 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine (CID 87358909) is 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine.
What is the SMILES notation for 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine?
The canonical SMILES for 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine is CC/N=C(\N)NOP(N)(=O)ON/C(N)=N/CC.
What is the InChIKey of 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine?
The InChIKey is LJDVYLACJGSKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N7O3P/c1-3-10-5(7)12-15-17(9,14)16-13-6(8)11-4-2/h3-4H2,1-2H3,(H2,9,14)(H3,7,10,12)(H3,8,11,13).
What are the key properties of 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine?
1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine has a molecular weight of 267.23 g/mol, XLogP of -1.24, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[amino-[(N'-ethylcarbamimidoyl)amino]oxyphosphoryl]oxy-2-ethylguanidine is sourced from PubChem (CID 87358909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).