About triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane
triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane (PubChem CID 87359233) has the molecular formula C12H24O12Si2
and a molecular weight of 416.48 g/mol. Its IUPAC name is triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane.
Molecular Properties
| Compound Name | triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane |
| PubChem CID | 87359233 |
| Molecular Formula | C12H24O12Si2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane |
| SMILES | CC(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O.CC(C)(C)O[Si](O)(O)O |
| InChI | InChI=1S/C8H12O8Si.C4H12O4Si/c1-5(9)13-17(14-6(2)10,15-7(3)11)16-8(4)12;1-4(2,3)8-9(5,6)7/h1-4H3;5-7H,1-3H3 |
| InChIKey | DVRNNSLLRFYZNR-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 175.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane?
The IUPAC name of triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane (CID 87359233) is triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane.
What is the SMILES notation for triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane?
The canonical SMILES for triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane is CC(=O)O[Si](OC(C)=O)(OC(C)=O)OC(C)=O.CC(C)(C)O[Si](O)(O)O.
What is the InChIKey of triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane?
The InChIKey is DVRNNSLLRFYZNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O8Si.C4H12O4Si/c1-5(9)13-17(14-6(2)10,15-7(3)11)16-8(4)12;1-4(2,3)8-9(5,6)7/h1-4H3;5-7H,1-3H3.
What are the key properties of triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane?
triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane has a molecular weight of 416.48 g/mol, XLogP of -1.11, 5 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for triacetyloxysilyl acetate;trihydroxy-[(2-methylpropan-2-yl)oxy]silane is sourced from PubChem (CID 87359233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).