About 3-methoxydioxiran-3-ol
3-methoxydioxiran-3-ol (PubChem CID 87359266) has the molecular formula C2H4O4
and a molecular weight of 92.05 g/mol. Its IUPAC name is 3-methoxydioxiran-3-ol.
Molecular Properties
| Compound Name | 3-methoxydioxiran-3-ol |
| PubChem CID | 87359266 |
| Molecular Formula | C2H4O4 |
| Molecular Weight | 92.05 g/mol |
| Exact Mass | 92.01 |
| IUPAC Name | 3-methoxydioxiran-3-ol |
| SMILES | COC1(O)OO1 |
| InChI | InChI=1S/C2H4O4/c1-4-2(3)5-6-2/h3H,1H3 |
| InChIKey | NNPGKYBGSLBIHU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.05 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxydioxiran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxydioxiran-3-ol?
The IUPAC name of 3-methoxydioxiran-3-ol (CID 87359266) is 3-methoxydioxiran-3-ol.
What is the SMILES notation for 3-methoxydioxiran-3-ol?
The canonical SMILES for 3-methoxydioxiran-3-ol is COC1(O)OO1.
What is the InChIKey of 3-methoxydioxiran-3-ol?
The InChIKey is NNPGKYBGSLBIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O4/c1-4-2(3)5-6-2/h3H,1H3.
What are the key properties of 3-methoxydioxiran-3-ol?
3-methoxydioxiran-3-ol has a molecular weight of 92.05 g/mol, XLogP of -0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxydioxiran-3-ol is sourced from PubChem (CID 87359266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).