About disodium;2-hydroxybutanedioate
disodium;2-hydroxybutanedioate (PubChem CID 8736) has the molecular formula C4H4Na2O5
and a molecular weight of 178.05 g/mol. Its IUPAC name is disodium;2-hydroxybutanedioate.
Molecular Properties
| Compound Name | disodium;2-hydroxybutanedioate |
| PubChem CID | 8736 |
| Molecular Formula | C4H4Na2O5 |
| Molecular Weight | 178.05 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | disodium;2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O5.2Na/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | WPUMTJGUQUYPIV-UHFFFAOYSA-L |
| XLogP | -9.75 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.05 |
| LogP ≤ 5 | -9.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze disodium;2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-hydroxybutanedioate?
The IUPAC name of disodium;2-hydroxybutanedioate (CID 8736) is disodium;2-hydroxybutanedioate.
What is the SMILES notation for disodium;2-hydroxybutanedioate?
The canonical SMILES for disodium;2-hydroxybutanedioate is O=C([O-])CC(O)C(=O)[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-hydroxybutanedioate?
The InChIKey is WPUMTJGUQUYPIV-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O5.2Na/c5-2(4(8)9)1-3(6)7;;/h2,5H,1H2,(H,6,7)(H,8,9);;/q;2*+1/p-2.
What are the key properties of disodium;2-hydroxybutanedioate?
disodium;2-hydroxybutanedioate has a molecular weight of 178.05 g/mol, XLogP of -9.75, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-hydroxybutanedioate is sourced from PubChem (CID 8736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).