2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid

C4H2BrN3O3S2 — CID 87360742

IUPAC2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid
SMILESO=S(=O)(O)c1cn2nc(Br)sc2n1
InChIInChI=1S/C4H2BrN3O3S2/c5-3-7-8-1-2(13(9,10)11)6-4(8)12-3/h1H,(H,9,10,11)
InChIKeyUBIOXKQADGNGHW-UHFFFAOYSA-N
MW284.12 g/mol
LogP0.80
Rot. Bonds1

About 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid

2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid (PubChem CID 87360742) has the molecular formula C4H2BrN3O3S2 and a molecular weight of 284.12 g/mol. Its IUPAC name is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid.

Molecular Properties

Compound Name2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid
PubChem CID87360742
Molecular FormulaC4H2BrN3O3S2
Molecular Weight284.12 g/mol
Exact Mass282.87
IUPAC Name2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid
SMILESO=S(=O)(O)c1cn2nc(Br)sc2n1
InChIInChI=1S/C4H2BrN3O3S2/c5-3-7-8-1-2(13(9,10)11)6-4(8)12-3/h1H,(H,9,10,11)
InChIKeyUBIOXKQADGNGHW-UHFFFAOYSA-N
XLogP0.80
TPSA84.56 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.12
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid?
The IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid (CID 87360742) is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid.
What is the SMILES notation for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid?
The canonical SMILES for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid is O=S(=O)(O)c1cn2nc(Br)sc2n1.
What is the InChIKey of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid?
The InChIKey is UBIOXKQADGNGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrN3O3S2/c5-3-7-8-1-2(13(9,10)11)6-4(8)12-3/h1H,(H,9,10,11).
What are the key properties of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid?
2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid has a molecular weight of 284.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole-6-sulfonic acid is sourced from PubChem (CID 87360742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).