About N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine
N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine (PubChem CID 87361427) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine.
Molecular Properties
| Compound Name | N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine |
| PubChem CID | 87361427 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine |
| SMILES | C=CCN.C=CCN(C)C |
| InChI | InChI=1S/C5H11N.C3H7N/c1-4-5-6(2)3;1-2-3-4/h4H,1,5H2,2-3H3;2H,1,3-4H2 |
| InChIKey | TXNVFWWJJURORP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine?
The IUPAC name of N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine (CID 87361427) is N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine.
What is the SMILES notation for N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine?
The canonical SMILES for N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine is C=CCN.C=CCN(C)C.
What is the InChIKey of N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine?
The InChIKey is TXNVFWWJJURORP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C3H7N/c1-4-5-6(2)3;1-2-3-4/h4H,1,5H2,2-3H3;2H,1,3-4H2.
What are the key properties of N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine?
N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine has a molecular weight of 142.25 g/mol, XLogP of 0.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylprop-2-en-1-amine;prop-2-en-1-amine is sourced from PubChem (CID 87361427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).