C29H21F5N2O2 — CID 87361857
1-[(2,4-dimethylphenyl)methyl]-2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-6-(4-phenoxyphenyl)pyridine-3-carbonitrile (PubChem CID 87361857) has the molecular formula C29H21F5N2O2 and a molecular weight of 524.49 g/mol. Its IUPAC name is 1-[(2,4-dimethylphenyl)methyl]-2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-6-(4-phenoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 1-[(2,4-dimethylphenyl)methyl]-2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-6-(4-phenoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 87361857 |
| Molecular Formula | C29H21F5N2O2 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-[(2,4-dimethylphenyl)methyl]-2-oxo-4-(1,1,2,2,2-pentafluoroethyl)-6-(4-phenoxyphenyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(Cn2c(-c3ccc(Oc4ccccc4)cc3)cc(C(F)(F)C(F)(F)F)c(C#N)c2=O)c(C)c1 |
| InChI | InChI=1S/C29H21F5N2O2/c1-18-8-9-21(19(2)14-18)17-36-26(15-25(24(16-35)27(36)37)28(30,31)29(32,33)34)20-10-12-23(13-11-20)38-22-6-4-3-5-7-22/h3-15H,17H2,1-2H3 |
| InChIKey | NTYOIJJJTLFHNQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|