About 10-piperidin-1-yldeca-2,4-dienamide
10-piperidin-1-yldeca-2,4-dienamide (PubChem CID 87361937) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is 10-piperidin-1-yldeca-2,4-dienamide.
Molecular Properties
| Compound Name | 10-piperidin-1-yldeca-2,4-dienamide |
| PubChem CID | 87361937 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 10-piperidin-1-yldeca-2,4-dienamide |
| SMILES | NC(=O)C=CC=CCCCCCN1CCCCC1 |
| InChI | InChI=1S/C15H26N2O/c16-15(18)11-7-4-2-1-3-5-8-12-17-13-9-6-10-14-17/h2,4,7,11H,1,3,5-6,8-10,12-14H2,(H2,16,18) |
| InChIKey | DSDKRVQJVHUMSN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 10-piperidin-1-yldeca-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-piperidin-1-yldeca-2,4-dienamide?
The IUPAC name of 10-piperidin-1-yldeca-2,4-dienamide (CID 87361937) is 10-piperidin-1-yldeca-2,4-dienamide.
What is the SMILES notation for 10-piperidin-1-yldeca-2,4-dienamide?
The canonical SMILES for 10-piperidin-1-yldeca-2,4-dienamide is NC(=O)C=CC=CCCCCCN1CCCCC1.
What is the InChIKey of 10-piperidin-1-yldeca-2,4-dienamide?
The InChIKey is DSDKRVQJVHUMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c16-15(18)11-7-4-2-1-3-5-8-12-17-13-9-6-10-14-17/h2,4,7,11H,1,3,5-6,8-10,12-14H2,(H2,16,18).
What are the key properties of 10-piperidin-1-yldeca-2,4-dienamide?
10-piperidin-1-yldeca-2,4-dienamide has a molecular weight of 250.39 g/mol, XLogP of 2.63, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-piperidin-1-yldeca-2,4-dienamide is sourced from PubChem (CID 87361937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).