C24H25F2N5O4S — CID 87365227
2,2-difluoroethyl N-[4-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate (PubChem CID 87365227) has the molecular formula C24H25F2N5O4S and a molecular weight of 517.56 g/mol. Its IUPAC name is 2,2-difluoroethyl N-[4-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate.
| Compound Name | 2,2-difluoroethyl N-[4-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 87365227 |
| Molecular Formula | C24H25F2N5O4S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 2,2-difluoroethyl N-[4-[10-(benzenesulfonyl)-4-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]carbamate |
| SMILES | Cc1nc2cnc3c(ccn3S(=O)(=O)c3ccccc3)c2n1C1CCC(NC(=O)OCC(F)F)CC1 |
| InChI | InChI=1S/C24H25F2N5O4S/c1-15-28-20-13-27-23-19(11-12-30(23)36(33,34)18-5-3-2-4-6-18)22(20)31(15)17-9-7-16(8-10-17)29-24(32)35-14-21(25)26/h2-6,11-13,16-17,21H,7-10,14H2,1H3,(H,29,32) |
| InChIKey | NCRRNCPTOZURSD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |