About [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate
[[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate (PubChem CID 87365560) has the molecular formula C24H21ClN2O4
and a molecular weight of 436.90 g/mol. Its IUPAC name is [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate.
Molecular Properties
| Compound Name | [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
| PubChem CID | 87365560 |
| Molecular Formula | C24H21ClN2O4 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate |
| SMILES | COc1ccc(C2(c3cccc(-c4cccc(Cl)c4)c3)COC(NOC=O)=N2)cc1C |
| InChI | InChI=1S/C24H21ClN2O4/c1-16-11-20(9-10-22(16)29-2)24(14-30-23(26-24)27-31-15-28)19-7-3-5-17(12-19)18-6-4-8-21(25)13-18/h3-13,15H,14H2,1-2H3,(H,26,27) |
| InChIKey | IMERSNVHXCGETG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate?
The IUPAC name of [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate (CID 87365560) is [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate.
What is the SMILES notation for [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate?
The canonical SMILES for [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate is COc1ccc(C2(c3cccc(-c4cccc(Cl)c4)c3)COC(NOC=O)=N2)cc1C.
What is the InChIKey of [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate?
The InChIKey is IMERSNVHXCGETG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21ClN2O4/c1-16-11-20(9-10-22(16)29-2)24(14-30-23(26-24)27-31-15-28)19-7-3-5-17(12-19)18-6-4-8-21(25)13-18/h3-13,15H,14H2,1-2H3,(H,26,27).
What are the key properties of [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate?
[[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate has a molecular weight of 436.90 g/mol, XLogP of 4.63, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-[3-(3-chlorophenyl)phenyl]-4-(4-methoxy-3-methylphenyl)-5H-1,3-oxazol-2-yl]amino] formate is sourced from PubChem (CID 87365560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).