C28H33N2O4S2+ — CID 87365904
[2-(benzylamino)-2-oxoethyl]-[(1S,2R)-2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium (PubChem CID 87365904) has the molecular formula C28H33N2O4S2+ and a molecular weight of 525.72 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl]-[(1S,2R)-2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium.
| Compound Name | [2-(benzylamino)-2-oxoethyl]-[(1S,2R)-2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium |
|---|---|
| PubChem CID | 87365904 |
| Molecular Formula | C28H33N2O4S2+ |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl]-[(1S,2R)-2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium |
| SMILES | C[N+](C)(CC(=O)NCc1ccccc1)C1C2CC[C@@H]1[C@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C28H32N2O4S2/c1-30(2,18-25(31)29-17-19-8-4-3-5-9-19)26-20-12-13-21(26)22(16-20)34-27(32)28(33,23-10-6-14-35-23)24-11-7-15-36-24/h3-11,14-15,20-22,26,33H,12-13,16-18H2,1-2H3/p+1/t20?,21-,22-,26?/m1/s1 |
| InChIKey | AZOWZOBDILNHGA-OLJONYEBSA-O |
| XLogP | 4.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|