About N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium
N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium (PubChem CID 87366312) has the molecular formula C19H27NRu-6
and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium |
| PubChem CID | 87366312 |
| Molecular Formula | C19H27NRu-6 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium |
| SMILES | CC(NCC1CCCCC1)[c-]1cccc1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C14H22N.C5H5.Ru/c1-12(14-9-5-6-10-14)15-11-13-7-3-2-4-8-13;1-2-4-5-3-1;/h5-6,9-10,12-13,15H,2-4,7-8,11H2,1H3;1-5H;/q-1;-5; |
| InChIKey | MWDOBJGVOBIUNR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium?
The IUPAC name of N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium (CID 87366312) is N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium.
What is the SMILES notation for N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium?
The canonical SMILES for N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium is CC(NCC1CCCCC1)[c-]1cccc1.[Ru].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium?
The InChIKey is MWDOBJGVOBIUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N.C5H5.Ru/c1-12(14-9-5-6-10-14)15-11-13-7-3-2-4-8-13;1-2-4-5-3-1;/h5-6,9-10,12-13,15H,2-4,7-8,11H2,1H3;1-5H;/q-1;-5;.
What are the key properties of N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium?
N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium has a molecular weight of 370.50 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-1-cyclopenta-2,4-dien-1-ylethanamine;cyclopentane;ruthenium is sourced from PubChem (CID 87366312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).