About [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate
[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate (PubChem CID 87366736) has the molecular formula C16H18F3N3O4S
and a molecular weight of 405.40 g/mol. Its IUPAC name is [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate.
Molecular Properties
| Compound Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate |
| PubChem CID | 87366736 |
| Molecular Formula | C16H18F3N3O4S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate |
| SMILES | O=C(NC1CC1)ON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H18F3N3O4S/c17-16(18,19)11-2-1-3-14(10-11)27(24,25)22-8-6-13(7-9-22)21-26-15(23)20-12-4-5-12/h1-3,10,12H,4-9H2,(H,20,23) |
| InChIKey | ICJHYNZBGPVTFN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate?
The IUPAC name of [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate (CID 87366736) is [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate.
What is the SMILES notation for [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate?
The canonical SMILES for [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate is O=C(NC1CC1)ON=C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1.
What is the InChIKey of [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate?
The InChIKey is ICJHYNZBGPVTFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3N3O4S/c17-16(18,19)11-2-1-3-14(10-11)27(24,25)22-8-6-13(7-9-22)21-26-15(23)20-12-4-5-12/h1-3,10,12H,4-9H2,(H,20,23).
What are the key properties of [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate?
[[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate has a molecular weight of 405.40 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[1-[3-(trifluoromethyl)phenyl]sulfonylpiperidin-4-ylidene]amino] N-cyclopropylcarbamate is sourced from PubChem (CID 87366736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).